Solutions
Quantifying Solutions
Equilibrium
Equilibrium Constant (K)
Q and Le Chatelier's Principle
100

This is the component of a solution which is dissolved. 

What is the solute?

100

This is the percentage of the total mass of solution that comes from an indicated species. 

What is mass percent?

100

These types of reactions don't go to completion, but instead reach dynamic equilibrium. 

What are reversible reactions? 

100

This is what the value of the equilibrium constant tells us. 

What is the ratio of products to reactants present at equilibrium for a reaction at a specific temperature. 

100

This is what the value of Q tells us. 

What is the ratio of products to reactants present at any point other that equilibrium for a reaction at a specific temperature? 

200

This describes a solution with a relatively low amount of solute per unit volume. 

What is dilute? 

200

When calculating the mole fraction, this is what should be in the denominator. 

What is the sum of the moles of solute and moles of solvent (moles of solution)? 

200

These values are equal to each other when a reaction is at equilibrium. 

What are the rates of the forward and reverse reactions? 

200

These indicate that the associated value shows the molarity of a specific solute. 

What are square brackets? 

200

This relationship between Q and K indicates that the reverse reaction will proceed until equilibrium is reached. 

What is K<Q ?

300

These are the three major factors influencing rate of solvation.

What are surface area of the solute, agitation, and temperature of the solvent?

300

This is the molarity when 0.25 mol of NaCl are dissolved in 2000 mL of water. 

What is 0.125 M (mol/L)?

300

These types of reactants and products should not be included in the equilibrium expression. 

What are solids and liquids?

300

These are the values that the equilibrium expression should be written in terms of if the reversible reaction consists of gaseous reactants and products. 

What are partial pressures?

300

This is the conclusion made about whether or not the reaction:

2 N2 (g) + O2 (g) <-> 2 N2O (g)

is at equilibrium if K = 4.08 x 108 and [N2] = 2.0x10-4 M, [O2] = 0.00245 M, and [N2O] = 0.2 M. 

What is "the system is at equilibrium"?

400

This is the general rule of solubility. 

What is "Like dissolves like"?

400

This is the volume of 6.0 M stock HCl solution that should be used to prepare 450 mL of 0.880 M HCl solution.

What is 0.066 L (66 mL)?

400

This is how reactant and product concentrations change once equilibrium has been reached. 

What is "concentrations do not change (are constant) at equilibrium"?

400

This is the equilibrium expression for the reaction: 

CO2 (g) + Li2O (s) <-> Li2CO3 (s)

What is K = 1/PCO2

400

This is the direction the following reaction would shift if O2 was removed: 

2 BaO2 (s) <-> 2 BaO (s) + O2 (g)

What is forward/right/toward products?

500

These are the three steps in creating a supersaturated solution.

What are heat the saturated solution, add and dissolve more solute, and allow the now supersaturated solution to slowly cool. 

500

This is the mass, in grams, of KCl (molar mass = 74.55 g/mol) needed to completely react with 1.47 L of a 0.136 M (Pb(NO3)2 solution according to the equation: 

2 KCl + Pb(NO3)2 -> 2 KNO3 + PbCl2

What is 29.8 g KCl?

500

This is the equilibrium expression for the reaction: 

CH3COOH(aq) + H2O(l)<>CH3COO-(aq) + H3O+(aq)

What is K = [CH3COO-][H3O+]/[CH3COOH] ?

500

What is the value of K if in the reaction 

2 NO (g) + O2 (g) <-> 2 NO2 (g)

is performed and the concentrations of the reacting species at equilibrium are found to be [NO] = 0.0542 M, [O2] = 0.127 M, and [NO2] = 15.5 M.

What is 6.44 x 105?

500

This is the direction the following reaction would shift if the volume was increased: 

2 BaO2 (s) <-> 2 BaO (s) + O2 (g)

What is forward/right/toward products?

M
e
n
u