Naming game
The product of adding an oxygen to ethanol
What is a vinegar or acetic acid
The type the reaction between an alkane and a halogen
What is a substitution or halogenation reaction
The repeating unit in polyethylene
What is C2H4
The condensed structural formula is CH3CH2CH2N(CH3)2
What is dimethylpropanamine
Name This alkane CH3CH2(CH3)CH2(CH3)CH2(CH3)CH2(CH3)CH2(CH3)CH3
2,3,4,5,6-pentamethylheptane
The name of a reaction or reagent used to distinguish between alkanes and alkenes
What is bromine or bromination (I'll accept addition)