This macromolecule is used to derive energy, is a constituent of genetic material (DNA & RNA), found in cell membranes.
What is a carbohydrate?
100
This bond forms between atoms that have similar electronegativities and share electrons.
What is a covalent bond?
100
These proteins in the cell membrane span the entire membrane or most of the membrane, penetrate into or through the inner hydrophobic core and are difficult to remove.
What are integral proteins?
100
This organelle is a barrier that marks the outer border of the cell and separates the cell contents from the surrounding extracellular environment.
What is the cell membrane?
100
This nucleic acid has uracil as one of its nitrogenous bases.
What is RNA?
200
This macromolecule is described as being hydrophobic and is a major component of the cell membrane.
What is a lipid?
200
The measure of an atom’s ability to attract electrons toward its nucleus.
What is electronegativity?
200
The cell membrane is selectively permeable and consists of a _________ core that restricts passage of water or
water soluble ions & molecules through
membrane.
What is hydrophobic?
200
This is the largest organelle that contains a cell's genetic material and directs the cell's activities and contains nucleoli.
What is the nucleus?
200
This nucleic acid does NOT have an OH group on carbon 2 of the ribose sugar on its nucleotides.
What is DNA?
300
This macromolecule can be composed of any of 20 amino acids and is formed from the linkage of amino acids via condensation reactions.
What is a protein?
300
pH is INVERSELY related to the hydrogen ion content –that is, the ______ the pH of a solution, the lower the hydrogen ion concentration (or the acidity) of the solution.
What is higher?
300
Name the three factors that affect the transport of ions and molecules across the cell membrane.
What is Hydrophobicity, Molecular Size, and Molecular Charge?
300
The name given to the gel-like, fluid component of the cytoplasm.
What is cytosol?
300
This form of RNA is made in the nucleus from a DNA template (pattern) in the process of TRANSCRIPTION.
What is mRNA?
400
This macromolecule is used to transmit genetic information from generation to generation and from cell to cell.
What is a nucleic acid?
400
This functional group can donate a H ion and it's presence lends acidic nature to molecule. It is also found in amino acids and fatty acids and can be ionized to form COO- + H.
What is a carboxyl group?
400
Processes by which extracellular fluids and
molecules dissolved in these fluids are enclosed in
vesicles and moved into the cell.
What is endocytosis?
400
Provide one example of a membrane bound organelle.
What is nucleus,
mitochondria, lysozymes, Golgi complex, or
endoplasmic reticulum?
400
_______molecules are SINGLE-STRANDED, but
loop and fold to ASSUME A 3-D SHAPE THAT
RESEMBLES A CLOVER LEAF. It is also involved in translation.
What is tRNA?
500
The nitrogenous bases Adenine and Guanine are oftern referred to as ______.
What are Purines?
500
For the molecule shown below, how many carbon atoms are present?
CH3(CH2)6(HC=CH)(CH2)4COOH
What is 14?
500
Name at least three of the factors that affect the rate of diffusion.
What is temperature, particle Size, magnitude of concentration gradient, permeability of membrane to a diffusing substance, and surface area of the membrane?
500
Provide the five functions of a membrane protein.
What is Structural support, Transport molecules, Enzymes, Receptors, Identity tags?
500
DNA is composed of a sugar-phosphate backbone (pole of a ladder), Nitrogenous base (half-rung of a ladder), and chains are ________ and COMPLEMENTARY.