This letter represents the constant for an equilibrium equation when the rate of the forward reaction is the same as the rate of the backwards reaction.
k
Which of these solvents would dissolve the most CaCl2?
NaCl aqueous solution
Deionized Water
CaF2 aqueous solution
Deionized water. The other's have a common ion.
If a molecule is a reducing agent in a reaction, is it accepting or producing moles of electrons?
Producing moles of electrons.
A reducing agent is BEING oxidized, therefore its charge is increasing, therefore it is producing electrons.
Which of these are strong acids?
HCl, HCN, HCOOCH, HNO3, HF, HClO3, H3PO4
HCl, HNO3, HClO3
If a given reaction produces more products than reactants, what does that say about DeltaG?
It is negative/spontaneous
HCOOH + OH- -> H2O + HCOO-
If more of the formate ion is added to this reaction, which direction will the reaction shift?
To the left/reactants.
The Ksp's of several compounds are given
Al(OH)3 Ksp= 3x10-34
Cd(IO3)2 Ksp= 2.5x10-8
Cu3(AsO4)2 Ksp= 7.95x10-36
Which compound is the least soluble?
Cu3(AsO4)2 [Copper(II) Arsenate]
Hg2+(aq) + 2e- -> Hg(l) Eo=0.85V
Cu2+(aq) + 2e- -> Cu(s) Eo=0.34V
Does the top half-cell or bottom half-cell represent the molecule being reduced?
Top half-cell
Regarding concentrations, when can you use the Henderson-Hasselbach equation to find pH?
When the concentration of products is equal to the amount of reactants (or the equivalence point)
What numerical value of R is used in the Arrenhius equation?
8.314 J/(mol K)
NH4+ + H2O -> NH3 + H3O+
If this reaction is endothermic, will more ammonia or ammonium be produced if the heat is decreased?
Ammonium
As the temperature increases for a solubility reaction, the solubility decreases. What does this mean about the enthalpy of the reaction?
It is exothermic/ DeltaH is -
3 As2O3 + 4 NO3- + 7 H2O + 4 H+ -> 6 H3AsO4 + 2 N2O2
How many moles of electrons are transferred in the reaction above?
4 moles of electrons
If 0.25M of HCOOH yields 6.71x10-3M of both H3O+ and COOH-, what is the Kb of HCOOH?
5.6x10-11
Ka=[H3O+][COOH-]/[HCOOH]
Ka=1.8x10-4
Kw/Ka=Kb
If DeltaS is negative, and DeltaH is positive, when is the reaction spontaneous?
At low temperatures
N2(g) + 3H2(g) -> 2NH3(g)
The above reaction is endothermic and occurs in a container. Where will the reaction shift if the container suddenly becomes smaller?
To the right. Decreased volume = increased pressure, goes to the side with less moles of gas
Give the solubility equilibrium equation for this reaction:
Fe2(HPO4)3 -> 2Fe3++3HPO42-
Ksp = [4s2][27s3] OR
Ksp = [108s5]
Fe3+(aq) + 3e- -> Fe(s) Eo=0.04V
Ag+(aq) + e- -> Ag(s) Eo=0.80V
Which of the half-cells listed would gain mass in a galvanic cell?
Bottom, the silver
It has a higher reduction potential, so it is reduced, so it is the cathode, cathode's gain mass during electrolysis.
Calculate the pH of a 0.25 solution of HC2H3O2 if the Ka of acetic acid is 1.8x10-5.
2.67
1.8x10-5= [H3O+][C2H3O2-]/[HC2H3O2]
1.8x10-5= [x][x]/[0.25-x] (drop the x in reactants)
x=0.002121, -log(x)=2.67
Keq is 1.83x10-12 for a reaction at 372K. What is DeltaG for this experiment?
83.6 KJ/mol
DeltaG= -RTln(k)
2HI -> I2 + H2
If there is 0.75M of HI initially in the mixture, and the equilibrium concentration of I2 is 0.3M, what is the equilibrium concentration of HI?
0.15M
2HI -> I2 + H2
I 0.75M 0M 0M
C -2x +x +x
E 0.75-2x 0.3M 0.3M
x=0.3M so 0.75M - 2x = 0.15M
Look at the following equation:
NaCl2 -> Na+ + 2Cl-
Given Ksp = 32, what is the final molarity of Na+?
2M
Ksp = [Na][Cl]2
32 = [s][4s2]
s=2M
2Cr2O72- + 14H+ + 6Cl- -> 2Cr3+ + 3Cl2 + 7H2O
Which molecule is the reducing agent in this full-cell reaction?
6Cl- -> 3Cl2 + 6e-
Calculate the pH of a solution if 30.5g of NaF is dissolved in 650mL of water. The Kb of F- is
1.471x10-11.
8.61
30.5g x 1g/42mol x 1/0.65L = 0.117M
Ka = [HF][OH-]/[F-]
1.471x10-11=[x][x]/[0.117-x] (drop the x)
x=4.05x10-6 -log(x)=5.39
14-5.39=8.61
Look at this Table for 2NO2 + O2 -> N2O4:
[NO2] [O2] Reaction Rate
0.1M 0.1M 0.000125M/s
0.2M 0.1M 0.000500M/s
0.1M 0.2M 0.000250M/s
What is the Rate law expression?
rate = k[NO2]2[O2]