How many solutions does a linear trig function have without restrictions?
An infinite amount of solutions.
What is a compound angle?
2 or more angles combined into a trigonometric function.
What is a double angle?
When you have a angle that is double the amount of the original angle.
When solving trig Identities what is the final goal?
To have the left side equal the right side.
Multiple choice, select the correct answer:
solve for: cosx = sin2x
a) x= π/6, 5π/6 b) x=11π/6, 7π/6
c) x= -π/6, -5π/6 d) x= π/3, 2π/3
Correct answer is a)
Solve for x on the interval 0<x<2π
1+tan2x=2tanx
π/4 and 5π/4
True or False: Is Sin(A+B)= CosACosB-SinASinB
False because Sin(A+B)=SinACosB+CosASinB
True or False: Is Sin2A=2SinACosA
True
True or False: Does Tan2x =sec2x+1
False Tan2x =sec2x-1
True or False
If tan(θ) = 5 /7 , then sin(θ) = 5 and cos(θ) = 7.
False sinθ=5/√74 and cosθ =7√74
2(sinx+1)=3
Solve for x if 0<x<2π
π/6, 5π/6
Determine exact values for: Sin(π+π/6)
-1/2 is the exact values for Sin(π+π/6)
Evaluate for: (2Sin45)(cos45)=?
Sin90-->1
Sin4θ-Cos4θ=2sin2θ-1
LS=RS
Determine the solutions for each equation where 0<x<2π: 3-3sinx-2cos2x=0
π/6, π/2, 5π/6