Literature
What is the name of the Jewish holy text
Torrah
what is the most popular sport globally
Soccer
In what country is Siberia
Russia
Who was the leader of Germany during World War 2
Adolf Hitler
What are atom made up of
Protons, Neutrons, Electrons
What Shakespeare play take place in the Roman Empire
Julius Ceasar
Where were the first-ever Olympics held
Greece
What is the longest river in the world
Nile
Where were the D-Day invasions
Normandy
What infinite irrational value is used to calculate the area of a circle (among other things)
Pi
What is the name of the book that inspired John Lennons killer
Catcher in the Rye
Name any of the boxing heavyweight champions since Lennox Louis
Oelexander Usyk, Tyson Fury, Anthony Joshua, Deontay Wilder, Vitaly/Wladimir Klitschko, Daniel Dubios, ect
What company made a car that has one horsepower per kilogram of weight
Konissegg
Who where the punic wars imbetween
What is the law of Sines
Sin(A)/a=Sin(B)/b=Sin(C)/c
What languages were the first bibles written in
Aramaic, Hebrew, Greek
What type of Ski bindings can be used for walking up a mountain and then adjusted to also ski down.
Who are the three artists of "Ohne Mein Team"
Maxwell, Bonez MC, RAF Camora
Where was the failed British invasion of the Ottoman Empire durring World War 1
Gallipoli
What constant time the frequency of an electro magnetic wave gives the energy of a photon?
Planks constant
What American novel's main antagonist is a giant albino who is believed to be the Devil (hint available)
Blood Meridian
What was the first recreational sailing race around the world or who won it
Golden Globe Race, Sir Robin Knox-Johnston
What is the oldest flag still in use
Denmark
What was the name of the combined English and French lands ruled by English monarchs durring the 100 years war
Angevin Empire
What is the noble gas electron configuration of Potasium
Ar 4s1