What are the first 10 digits of pi?
3.141592653
Where is DNA stored in the cell?
What are the products of the following reaction?
NaOH + HCl
H2O and NaCl (salt water!)
The movie Hidden Figures is about this woman who helped calculate important trajectories in the space race.
Katherine Johnson
Which Identifying feature is different for identical twins?
Fingerprints
Free fall of an object is an example of:
a. constant velocity motion
b. uniformly accelerated motion
c. non-uniformly accelerated motion
d. zero velocity motion
b. uniformly accelerated motion
What is the largest organ in the human body?
Skin
What is the formula of Nitric Acid?
HNO3
Who is the first woman to win a Nobel Prize?
(and the only woman to win two!)
Marie Curie
What is the hardest material on earth?
Diamond
Solve for X
x3 - 4x2 - 3x = 9x
x = -2, 0, 6
Aside from marine mammals, what is the only kind of mammal native to New Zealand?
Bats
What does FTIR show? What does it tell you about a compound?
The absorbance of IR radiation.
It can give information about the functional groups present in a compound.
What did Rosalind Franklin help discover?
The structure of DNA
What is the study of pollen and spores called?
Palynology
20.8m
vf2 = vi2 + 2a(xf - xi) (25)2 = (0)2 + 2(15)(xf - 0)625 = 30xf xf= 20.8m
20.8 - 0 = 20.8
What are the requirements for a molecule to pass through the cell wall by diffusion?
It must be a small nonpolar molecule
2HI --> I2 + H2
If the concentration of HI is increased from 2M to 4M, the rate of reaction goes from 3.0 x 10-4 to 1.2 x 10-3.
What is the order of this reaction?
Second order
Who was the first woman in space?
Valentina Tereshkova
What is an SSRI and what does it stand for?
Selective Serotonin Reuptake Inhibitors are a class of Antidepressant drugs
What is the derivative of 5ex + 7xcos(x)
5ex + 7cos(x) - 7xsin(x)
Given an mRNA sequence of AUUGCCGAU, what is the sequence of the anticodon on the tRNA?
UAACGGCUA
What is the name of this organic compound
CH3CH2(CH2CH3)CH2CH2(CH3)CH2CH3
2-ethyl-4-methylhexane
Who is considered the founder of scientific computing and was the first computer programmer?
Ada Lovelace
What type of rocks are fossils found in?
Sedimentary