This letter represents the constant for an equilibrium equation when the rate of the forward reaction is the same as the rate of the backwards reaction.
k
The Ksp's of several compounds are given
Al(OH)3 Ksp= 3x10-34
Cd(IO3)2 Ksp= 2.5x10-8
Cu3(AsO4)2 Ksp= 7.95x10-36
Which compound is the least soluble?
Cu3(AsO4)2 [Copper(II) Arsenate]
If a molecule is a reducing agent in a reaction, is it accepting or producing moles of electrons?
Producing moles of electrons.
A reducing agent is BEING oxidized, therefore its charge is increasing, therefore it is producing electrons.
Which of these are strong acids?
HCl, HCN, HCOOCH, HNO3, HF, HClO3, H3PO4
HCl, HNO3, HClO3
What are the oxidation numbers in K2CO3?
K = +1
C = +4
O = -2
HCOOH + OH- -> H2O + HCOO-
If more of the formate ion (HCOO-) is added to this reaction, which direction will the reaction shift?
To the left/reactants.
If ∆S is negative, and ∆H is positive, when is the reaction spontaneous?
At low temperatures
Hg2+(aq) + 2e- -> Hg(l) Eo=0.85V
Cu2+(aq) + 2e- -> Cu(s) Eo=0.34V
Based on the half-cell potentials, what is the cell potential for the reaction? Write the complete reaction?
Hg2+(aq) + Cu(s) --> Hg(l) + Cu2+(aq)
Cell Potential: 0.51
What is the equilibrium volume of a titration of 0.0974M NaOH have been added to 57.0mL of 0.0466M HClO4
27.27mL
How many intermediates and transition states are there? Is this reaction endothermic or exothermic?
B, D, F = transition states
C, E = intermediates
reaction is exothermic
N2(g) + 3H2(g) -> 2NH3(g)
The above reaction is endothermic and occurs in a container. Where will the reaction shift if the container suddenly becomes smaller?
To the right. Decreased volume = increased pressure, goes to the side with less moles of gas
Keq is 1.83x10-12 for a reaction at 372K. What is ∆G for this experiment?
83.6 KJ/mol
∆G = -RTln(k)
Ce3+ + Pb → Ce + Pb4+
How many moles of electrons are transferred in the reaction above?
12 moles of electrons
If 0.25M of HCOOH yields 6.71x10-3M of both H3O+ and COOH-, what is the Kb of HCOOH?
5.6x10-11
Ka=[H3O+][COOH-]/[HCOOH]
Ka=1.8x10-4
Kw/Ka=Kb
A piece of zinc is dropped into 1.00 L of 0.100 M HCl and the following data was obtained:
Time Mass of Zinc
0s 0.016g
4s 0.014g
8s 0.012g
12s 0.010g
16s 0.008g
20s 0.006g
Calculate the Rate of Reaction in grams and moles of Zn consumed per second.
grams of Zn = 5.0 x 10-4 g/s
moles of Zn = 7.65 x 10-6 mol/s
The partial pressures of S2O, O2, and S2O4 are currently 0.174atm, 0.225atm, and 0.419atm respectively. Determine if the reaction is at equilibrium or if it will shift to the right or to the left. Kp = 110.8
2S2O(g) + O2(g) → S2O4(g)
K = 61.51
Shifts right
If ∆H rxn = −82 kJ/mol and ∆S = 109 J/mol · K, what is ∆G rxn for this reaction at 54°C? Is the reaction spontaneous?
∆G rxn = -117.6, reaction is spontaneous
Fe3+(aq) + 3e- -> Fe(s) Eo=0.04V
Ag+(aq) + e- -> Ag(s) Eo=0.80V
Which of the half-cells listed would gain mass in a galvanic cell?
Ag - It has a higher reduction potential (the cathode), cathode's gain mass during electrolysis.
Calculate the pH of a 0.25 solution of HC2H3O2 if the Ka of acetic acid is 1.8x10-5.
2.67
1.8x10-5= [H3O+][C2H3O2-]/[HC2H3O2]
1.8x10-5= [x][x]/[0.25-x] (drop the x in reactants)
x=0.002121, -log(x)=2.67
What is the standard potential for the voltaic cell using the Pb2+/Pb and Mg2+/Mg half reactions. Which metal is the cathode
Pb2+ + 2e- --> Pb E = -0.124 V
Mg2+ + 2e- --> Mg E = -2.37 V
Cathode: Pb2+/Pb
Standard Potential = 2.246 V
2HI -> I2 + H2
If there is 0.75M of HI initially in the mixture, and the equilibrium concentration of I2 is 0.3M, what is the equilibrium concentration of HI?
0.15M
2HI -> I2 + H2
I 0.75M 0M 0M
C -2x +x +x
E 0.75-2x 0.3M 0.3M
x=0.3M so 0.75M - 2x = 0.15M
For a generic process A → B, ΔH°sys = -174 kJ/mol and ΔS°surr = 243 J/K-mol. Assuming that ΔH°sys and ΔS°surr do not change with temperature, at what temperature in °C does the reaction go from being non-spontaneous to spontaneous?
716K
2Cr2O72- + 14H+ + 6Cl- -> 2Cr3+ + 3Cl2 + 7H2O
Which molecule is the reducing agent in this full-cell reaction?
6Cl- -> 3Cl2 + 6e-
Calculate the pH of a solution if 30.5g of NaF is dissolved in 650mL of water. The Kb of F- is
1.471x10-11.
8.61
30.5g x 1g/42mol x 1/0.65L = 0.117M
Ka = [HF][OH-]/[F-]
1.471x10-11=[x][x]/[0.117-x] (drop the x)
x=4.05x10-6 -log(x)=5.39
14-5.39=8.61
Look at this Table for 2NO2 + O2 -> N2O4:
[NO2] [O2] Reaction Rate
0.1M 0.1M 0.000125M/s
0.2M 0.1M 0.000500M/s
0.1M 0.2M 0.000250M/s
What is the Rate law expression?
rate = k[NO2]2[O2]