Alkenes have at least one double bond meaning they are _________.
What is unsaturated?
What is -ol?
The suffix/es for esters.
What is -yl -oate?
The product of the reaction between propene and H2 in the presence of a Ni-catalyst.
What is propane
The functional group for carboxylic acids.
What is COOH?
The strongest intermolecular bonds between alcohols.
What are hydrogen bonds?
The condensed structural formula is CH3CH(CH3)CH2CH(CH2CH3)CH2CH3
What is 4ethyl-2methyl-hexane?
For alkanes the _____ is given by CnH2n+2
What is the homologous series?
What is an alkane?
A plastic which is harder to recycle though it is stronger due to crosslinking.
What is thermosetting plastic?
The name is butanol.
What is C4H10O?
The 3 names of the 3 structural isomers of C5H12
What is pentane, 2-methylbutane and 2,2-dimethylpropane
The structure of 3-methyl-3hexanol
What is CH3CH2CH2(CH3)(OH)CH2CH3? or What is - draw the formula.
The process by which hydrocarbons are separated.
What is fractional distillation?