Trig Solving
This is sin of 30 degrees
What is 1/2?
This is what (x-3) and (x+3) are to x^2-9
This is how continuous compound interest is calculated
What is A(t)=Pe^(rt)?
This is the Pythagorean identity involving sine and cosine
This is the radius of a unit circle
What is 1?
This function is defined as adj/hyp on a right triangle
What is cosine?
This formula finds the amount of interest compounded continuously.
What is P(e)^(rt)
It's what a is in relation to the exponential growth formula a(1+r)x
What is the y-intercept or what is the principal?
This is referred to as the law of Cosines.
What is a2=b2+c2-2bcCos(A)?
This indicates a bounce on the x axis
What is a root of even multiplicity?
It's the reciprocal of cosine
What is secant?
This is what k does in the equation: y=f(x)+k
What is a vertical shift?
It's the simplification of logb(4)-logb(2).
What is logb(2) or logb(4/2)?
sin(A)/a=sin(B)/b=sin(C)/c
What is the law of sines?
It's what 4x5 is in 4x5+2x3+x
What is the leading term?
Its the period of sine and cosine
What is 2pi?
This formula: y=(a-h)^2+k in the context of a parabola
What is vertex form?
It's what this is called: A(t)=P(1+r/n)^(nt)
What is the Compound Interest formula?
This is the formula for arc length
s=r*theta
It's a different way to right sin(2*theta) and cos(2*theta)
What is the double angle formula?
The tangent of 60 degrees
What is sqrt(3)?
ab = 0 if and only if a=0 or b=0
What is the Zero Factor Principle?
This is the meaning of an odd function
What is f(x)=-f(-x)?
This is the conversion from polar to cartesian.
What is x=rcos(theat) and y=rsin(theta)?
It's the parametric equation of a circle at the point (h,k)
What is x(t)=rcos(t)+h and y(t)=rsin(t)+k?