a) Watch Dogs
b) Saint's Row IV
c) GTA V
What is GTA V
25 Seconds
What anime is this from?
(Bonus points if you get the song name, artist of the song, and/or which opening number it is)
Simply:
(2x^5y^5)/(3xy^5)*(x^4y)/(x^3y^3)
(2x)/(3y^4)
Find a word a that relates all three of these words:
throat / loser / spot
What is SORE
"I love you 3000"
(Bonus Points if you get the character correct)
- Tony Stark (or Iron Man), Avengers: Endgame
What Data Structure does this image represent:
What is Tree.
a) TF2
b) Apex
c) CSGO
What is CSGO
20 Seconds
What anime is this from?
(Bonus points if you get the song name, artist of the song, and/or which opening number it is)
What is Attack on Titan's OP 2 Jiyuu no Tsubasa by Linked Horizon
What is the solution to this:
csc((7pi)/4)+sin(pi)-tan((5pi)/6)
(sqrt3)/3-sqrt2
Find a word a that relates all three of these words:
aid / wagon / rubbber
"I'm vengeance"
(Bonus Points if you get the character correct)
- Batman, The Batman (2021)
This operating system was created by an American programmer Terry A. Davis. Davis designed this OS to be the prophesied Third Temple in the Bible and later described it as "a revelation from God."
What is Window's Vista. (jk it's templeOS)
a) Hollow Knight
b) Elden Ring
c) Darkest Dungeon
What is Elden Ring.
15 Seconds
What anime is this from?
(Bonus points if you get the song name, artist of the song, and/or which opening number it is)
What is JoJo's Bizarre Adventure: Battle Tendencies' OP 2 "BLOODY STREAM" by Coda
dy/dx (root(3)(x^2)-1/(sqrt(x^3)))
2/3x^(-1/3)+3/2x^(-5/2)
Find a word a that relates all three of these words:
pie / pot / belly
"Pizza Time!"
(Bonus Points if you get the character correct)
- Peter Parker (Spiderman), The Amazing Spider Man 2
This is the programming language for the following image:
What is BrainFuck.
a) Divinity: Original Sin 2
b) The Sims 4
c) Skyrim
What is Divinity: Original Sin 2
10 Seconds
What anime is this from?
(Bonus points if you get the song name, artist of the song, and/or which opening number it is)
What Is Death Note's OP 1 "the WORLD" by Nightmare
int_0^oo(1+2x)e^(-x)dx
3
Find a word a that relates all three of these words:
match / point / stick
what is MATCH
"Say 'Hello' to my little friend"
(Bonus Points if you get the character correct)
- Al Pacino, Scarface
What is the Time Complexity of this following code:
What is O(n).
a) American Truck Simulator
b) Lawn Mowing Simulator
c) PowerWash Simulator
What is American Truck Simulator
5 Seconds
What anime is this from?
(Bonus points if you get the song name, artist of the song, and/or which opening number it is)
What is Bleach's OP 1 "*~Asterisks~" by ORANGE RANGE
u=[[6],[5],[-3]], v=[[-2],[0],[1]], w=[[-2],[-1],[1]]
Express u as a linear commination of v and w
u=2v-5w
Find a word a that relates all three of these words:
illness / bus / computer
“Try not. Do or do not. There is no try.”
(Bonus Points if you get the character correct)
- Yoda, Star Wars Episode V: The Empire Strikes Back
Many programmers have a difficult time touching enough of this in their life. What is it?
Bro I don't even know.