Acids & Bases
Acids, Bases, and pH
Equilibrium, Ka, Kb, and buffers
Redox Reactions and Galvanic Cells
Entropy and Gibbs Free Energy
100

What is a bronsted acid? What is a bronsted base?

  • Bronsted acids are proton donors (lose one H+)

  • Bronsted bases are proton acceptors (gain one H+)
100

What are the conversions between [H3O+], [OH-], pH, and pOH? Draw them out.


100

Which of the following could be used to prepare a buffer, assuming the solutions were combined in roughly equimolar amounts? 

a. NaOH and NaCl 

b. HF and KF 

c. HBr and HCl

b. HF and KF; This is a weak acid-conjugate base pair, so it can be a buffer. 

a. would not be a buffer because NaOH is a strong base.

c. would not be a buffer because both HBr and HCl are strong acids.

100

Which substance is the oxidizing agent in the following reaction?

Ca(s) + Zn2+(aq) → Ca2+(aq) + Zn(s)

Zn2+(aq)

100

What sign is ΔS if the reaction is gaining disorder?

Positive

200

What is an arrhenius acid? What is an arrhenius base?

  • Arrhenius acids form hydronium (H3O+) ions in solution

  • Arrhenius bases form hydroxide (OH-) ions in solution

200

Air-saturated water has a hydronium ion concentration of 2.0×10−6 M. Calculate the pH of the solution.

pH = -log[H3O+]

pH = -log[2x10-6M]

pH = 5.70

200

C8H10N4O2 is a weak base. What is the value of Kb for C8H10N4O2 if a solution at equilibrium has 

[C8H10N4O2] = 0.050 M, [C8H10N4O2H+] = 5.0x10−3 M, and [OH] = 2.5x10−3 M?

Kb = ([OH-][HB+])/[B]

Kb= ((2.5x10−3)(5.0x10−3))/0.050

Kb = 2.5x10-4

200

In which one of the following molecules does sulfur have the smallest oxidation number? 

a) SO3

b) S2O32-

c) SO42- 

d) SO2

b) S2O32-

200

Rank the phases from greatest to least entropy.

(liquid, gas, solid)

Gas > liquid > solid

300

What is the conjugate base of the acid HBr?

Br-

300

Blood has a pH of 7.3. What is the hydronium ion concentration of whole blood? 


[H3O+]=10-pH

[H3O+]=10-7.3

[H3O+]= 5x10-8M

300

At equilibrium, a solution contains [CH3CO2H] = 0.0787 M and [H3O+]=0.00118M, [CH3CO2]=0.00118M. What is the value of Ka?

CH3CO2H(aq) + H2O(l) ⇌ H3O+(aq) + CH3CO2(aq)

Ka = ([H3O+][A-])/[HA]

Ka = (0.00118)2/(0.0787)

Ka = 1.77x10-5

300

What is E°red for the reaction 

Al(s) + 3 Ag+(aq) → 3Ag(s) + Al3+(aq)?   

Standard reduction potential for 

Al3+(aq) + 3e- → Al (s) = -1.66 V   E°cell = +2.46 V

 

Ecell = Eox + Ered

+2.46 = +1.66 + Ered

Ered = 0.8V

300

If the ΔS is positive and ΔH is negative, is the reaction spontaneous? 

It is spontaneous at all temperatures.

ΔG = ΔH - T*ΔS

400

Identify the bronsted acid, base, and two conjugate pairs for the following reaction:

HCl (aq) + NH3 (aq) → NH4+ (aq) + Cl- (aq)


HCl (aq) + NH3 (aq) → NH4+ (aq) + Cl- (aq)

acid          base           conj. acid     conj. base

400

Sea water has a hydronium ion concentration of 6.33x10-9. What is the hydroxide ion concentration?

[OH-] = Kw/[H3O+]

[OH-] = 1x10-14/6.33x10-9

[OH-] = 1.58x10-6

400

What is the pH of a 0.534M solution of formic HCO2H?

HCO2H(aq) + H2O(l) ⇌ H3O+(aq) + HCO2(aq)   Ka=1.8×10−4

R   HCO2H   H3O+   HCO2-

I    0.534        0          0

C      -x         +x        +x

E   0.534-x     x           x

Ka = x2/(0.534-x) *assume x is small

Ka = x2/0.534

1.8×10−4 = x2/0.534

0.534 x (1.8×10−4) = x*square root both sides*

x = 9.8x10-3 M = [H3O+] 

pH = -log[9.8x10-3 M] = 2.01

400

A galvanic cell is run for 240 seconds at a current of 15 amps. How many moles of electrons are produced?

15A x 240sec = 3600C

3600C x (1mol e-/96485C) = 0.037 moles e-

400

Calculate the free energy change for the synthesis of calcium oxide. At 25 ºC is the reaction spontaneous? 

2 Ca (s) + O2(g) ----> 2 CaO (s)

∆Hº = -1269.8 kJ/mol

∆Sº = -364.6 kJ/mol 

+ 107432.1 = ∆G

Non-spontaneous!


500

Name the formula for at least 3 of the 6 strong acids.

H2SO4   So

HI         I

HBr        Brought

HNO3     No

HCl         Clean

HClO4     Clothes

500

If moist soil has a hydroxide concentration of  3.19x10-5, what is the pH? 


There are two ways to solve this. 

a) [OH-] -> pOH -> pH

b) [OH-] -> [H3O+] -> pH

Either method is fine. The answer should be: 

pH = 9.5

500

Calculate the pH of an acetate buffer that is a mixture with 0.10 M acetic acid and 0.10 M sodium acetate. 

Ka = 1.8x10-5

R   CH3CO2H   H3O+   CH3CO2-

I

C

E

R   CH3CO2H   H3O+   CH3CO2-

I       0.10        0         0.10

C        -x         +x          +x

E      0.10-x       x       0.10+x

Ka = [H3O+][CH3CO2-]/[CH3CO2H]

1.8x10-5 = (x)(.10+x)/(.10-x) *assume x is small

1.8x10-5 = (x)(.10)/(.10)

x = 1.8x10-5 = [H3O+]

pH = -log[1.8x10-5] = 4.74

500

Balance the following redox reaction in basic solution:

MnO4- + C2O4-2 → Mn+2 + CO2


500

Determine the equilibrium constant for the following reaction at 298 K.

Cl(g) + O3(g) → ClO(g) + O2(g)       ΔG° = - 34.5 kJ

Use ∆Gº = -RT ln(K)


K = 1.2*106