Vocabulary
Minor Calculations
Big Calculations
Instrumentation
???
100

What is Le Chatelier's Principle?

A system will try to return to equilibrium if disturbed.

100

Calculate the ionic strength of a solution containing 0.3 M KCl and 0.2 M K2SO4.

0.9 M

100

Consider a mixture of the two solids, BaCl2∙2H2O and KCl. When the mixture is heated to 160 degrees C for 1 hour, the water of crystallization is driven off:

BaCl2∙2H2O(s) → BaCl2(s) + 2H2O(g)

A sample originally weighing 1.7839 g weighed 1.5623 g after heating. Calculate wt% Ba, K, and Cl in the original sample.

Ba 47.35%, K 8.279%, Cl 31.95%

100

What is the mobile phase?

The solvent moving through the column in chromatography. May be either a liquid or a gas.

100

If more oxygen is added to a methane combustion reaction, will the equilibrium shift towards the reactants, products, or neither?

Products

200

What is a systematic or method error?

A repeatable error made by making the same mistakes in measurement.

200

Find the molar absorptivity of a 0.0025 M KMnO4 solution whose absorbance is 4.53 when tested at 435 nm in a 1.00 cm cell.

1812 M-1cm-1

200

A solution of NaOH was standardized by titration of a known quantity of the primary standard, potassium hydrogen phthalate. Its concentration was determined to be 0.154 M. The NaOH was then used to standardize H2SO4.

H2SO4 + 2 NaOH → Na2SO4 + 2H2O

Titration of 50.00 mL of H2SO4 required 38.14 mL of NaOH solution. Calculate the concentration of H2SO4.

0.118 M H2SO4

200

What type of interference can be corrected by running a blank?

Background absorption

200

A data point that should be excluded from the data set; determined through Grubbs test.

Outlier

300

What type of titration measures the titrant by mass (not volume)?

Gravimetric titration.

300

Calculate spooled for the following data sets:

A: 24.57, 24.34, 26.57, 25.92, 25.77; B: 34.32, 32.84, 24.39, 30.84, 26.97.

0.06

300

What is the molarity of NaOH if 40.00 mL NaOH was used to titrate 0.5241 g sulfamic acid?

+H3NSO3- + OH- -> H2NSO3- + H2O

0.1349 M NaOH

300

What type of chromatography uses high pressure to force eluent through a closed column packed with micrometer-size particles?

High-pressure liquid chromatography (HPLC)

300

Something that can be added to a solution to prevent some impurities from reacting with the precipitant.

Masking agent

400

What is a buffer, and how is it formed?

A solution that resists changes in pH when small amounts of acid or base are added; adding a small amount of strong acid or base to a weak base or acid or by mixing a weak acid/base with a salt that contains the respective conjugate base/acid.

400

Calculate the pH of a solution that was made by adding 5 mL 0.106 M NaOH to 25 mL 0.102 M CH3COOH?

4.18

400

100.00 mL of 0.256 N K2Cr2O7 is titrated with 15.46 mL of 0.6781 N Fe3+. Find the potential at the cathode. Assume the total solution volume after additions is 235 mL and hydronium concentration is 1.0 x 10-3 M.

1.76 V

400

What instrumentation is involved for atomic absorption spectroscopy?

Source, sample, wavelength selector, detector, read out.

400
What is the solubility of BaCO3 in 0.50 M Na2CO3 solution?

Ksp = 5.0 x 10-9

1.00 x 10-8

500

What two properties does the extended Debye-Huckel equation relate, and what are definitions for each of these properties?

Activity coefficients and ionic strength; the activity coefficient is the ratio of the chemical activity of a substance to its molar concentration and is used to calculate the activity of a solution, which is a measure of the effective concentration of a species in a mixture; the ionic strength is a measure of the total concentration of ions in a given solution.

500

Write a charge balance for a solution of H2SO4 in water if the H2SO4 ionizes to HSO4- and SO42-.

[H+]=[OH-]+[HSO4-]+2[SO42-]

500

Ni2+ can be analyzed by a back titration with standard Zn2+ at pH 5.5 and xylenol orange indicator. A solution containing 25.00 mL of Ni2+ in dilute HCl was treated with 25.00 mL of 0.05283 M Na2EDTA. The solution was neutralized with NaOH, and the pH was adjusted to 5.5 with acetate buffer. The solution turned yellow when a few drops of indicator were added. Titration with 0.02299 M Zn2+ required 17.61 mL of Zn2+ to reach the red end point. What was the molarity of Ni2+ in the unknown?

0.03664 M Ni2+

500

Name the types of interference that occur in atomic spectroscopy.

Spectral, chemical, ionization.
500

Calculate E0 and K for the following reaction:

2F2 (g) + H2O <--> F2O(g) + H+ + 2F-

E0 = 0.722 V

K = 7 x 1048