Naming Polyatomic Ions
The name of a polyatomic ion that has Na and OH
What is Sodium Hydroxide?
The Chemical formula for carbon and hydroxide.
What is C(OH)4?
List the amount of atoms in this molecule: CH4
C = 1
H = 4
The balanced equation for: CaCl2 + H2SO4 —> CaSO4 + HCl
What is CaCl2 + H2SO4 —> CaSO4 + 2HCl?
A physical activity Cassidy likes to do.
What is Hiking/weight lifting?
The name of the following Molecule: Ga(CH₃COO)3
What is Gallium Acetate?
The Chemical formula for silicon and acetate.
What is Si(CH3COO)4?
List the amount of atoms in this molecule: Ca(OH)2
Ca = 1
O = 2
H = 2
The balanced equation for: NH3+O2—-> NO+H2O
What is 2NH3+O2—-> NO+3H2O?
Cassidy’s Favorite Color.
What is Green?
The name of the following Molecule: Pb + PO₄
What is Lead Phosphate?
The Chemical formula for potassium and phosphate.
What is K3PO4?
List the amount of atoms in this molecule: 2C15F33N
C = 30
F = 66
N = 2
The balanced equation for:
Pd(NO3)2+NaI—>PdI2+NaNO3
What is Pd(NO3)2+2NaI—>PdI2+2NaNO3?
Cassidy’s Favorite Element.
What is the element Bismuth?
The name of the following Molecule: Atomic number 52 + NO₂
What is Tellurium Nitrite?
The Chemical formula for phosphate and ammonium.
What is PO₄(NH₄)₃?
List the amount of atoms in this molecule: 2Ca(OH)2
Ca = 2
O = 4
H = 4
The balanced equation for: PCl5+H2O—> H3PO4+HCl
What is PCl5+4H2O—> H3PO4+5HCl?
The pets Cassidy has.
(+100 per one you can name)
What is a
cat and dog?
Names : (Archy and Cooper)
The name of the following Molecule: Atomic number 7 + CIO₃
What is Nitrogen Chlorate?
The Chemical formula for potassium and ferricyanide.
What is K3[Fe(CN)6]?
List the amount of atoms in this molecule: 4Fe4[Fe(CN)6]3
Fe = 28
C = 72
N = 72
The balanced equation for: Cu2S+HNO3—>
Cu(NO3)2+CuSO4+NO2+H2O
What is Cu2S+12HNO3—>Cu(NO3)2+CuSO4+10NO2+6H2O?
The name of the college Cassidy went to.
What is White Forest University?