Is that a MOLE on your face?
What name is given to the number 6.022x1023?
Avogadro's number
What defines the identity of an element?
The number of protons it has (its atomic number).
What results from two atoms sharing electrons?
A covalent bond
CH3OH
Methanol
On the periodic table, vertical columns are called ______, while horizontal rows are called ______.
Groups, periods
What is the difference between a compound's molecular and empirical formula?
- Molecular --> actual ratio of atoms
- Empirical --> simplest ratio of atoms
What shape describes p orbitals?
Hourglass
Forces between molecules are called...?
Intermolecular forces
CH2BrCH2CH3
1-bromopropane
The alkali metals correspond to group...?
1
How many hydrogen atoms are there in 1 mole of water?
1.2x1024
What would be the electron configuration for a Na+ ion (in Noble gas short form)?
[Ne]
What two conditions does a molecule have to meet to be considered polar?
- Bond is polar
- Pull for electrons doesn't cancel out (VSEPR)
CH3CH(CH3)CH2COH
2-methylbutanal
What happens to the atomic radii of elements as you go down a period?
They decrease.
What is the term we use to describe the mass of an ionic compound?
Relative formula unit mass
Which set of atomic orbitals fills up after 3d?
4p
Compounds with what type of bonding only conducts electricity when molten or dissolved?
Ionic compounds
CH3CH(CH3)COClCH2CH3
2-methyl, 3-chloropentan-3-one
What is an atom's first ionization energy?
The energy required to remove 1 mole of electrons from 1 mole of gaseous atoms.
How many carbon atoms are there in 4.0g of CO2?
5.5x1022
Is H2S a polar or non-polar molecule?
Polar
This form of intermolecular force is present in all atoms and molecules.
London dispersion forces.
CH3CHCHC(CH2CH3)ClCH2CH2Cl
4, 6-dichloro, 4-ethylhex-2-ene
What happens to an element's electron affinity as you move down a group?