Ch. 10: IMFs, heat of fusion/vaporization
Ch. 11: concentrations, titrations, dilutions
Ch. 12: Kinetics and Equilibrium
Ch. 13
100

How do IMFs affect boiling points, melting point, and vapor pressure? 

stronger IMFs increase boiling point and melting points


stronger IMFs decrease vapor pressure

100

What is the better solvent for I2: H2O or CH3(CH2)4CH3?

What is the better solvent for NaCl: H2O or CH3(CH2)4CH3?

What is the better solvent for KCl: H2O or CCl4?

For I2: CH3(CH2)4CH3

For NaCl: H2O

For KCl: H2O

100

Write the equilibrium constant expression for the following reaction: 

2 CuI(s) + I2(aq) → 2 Cu2+(aq) + 4 I-(aq)

[I-]4[Cu2+]2 / [I2]

100

Name 3 strong acids

HCl, HBr, HI, HNO3, HClO3, HClO4, H2SO4

200

What intermolecular forces are present in the following compounds:

Ar2

HClO

hydrogen chloride

ammonia

Ar2: dispersion only

HClO: dispersion, dipole-dipole, hydrogen bonding

hydrogen chloride: dispersion, dipole-dipole

ammonia: dispersion, dipole-dipole, hydrogen bonding

200

A chemist prepares a solution of silver(I) nitrate (AgNO3) by measuring out 94.1μmol of silver(I) nitrate into a 250 mL volumetric flask and filling the flask to the mark with water. 

Calculate the concentration in M of the chemist's silver(I) nitrate solution

3.76 x 10-4 M (mol/L)

200

Consider the reaction below:

2H2S(g) + 3O2(g) -> 2SO2(g) + 2H2O(g)

What would happen to the equilibrium if you removed some H2S?

the reaction would shift to the left

200

Identify the Bronsted-Lowry acid and base in the following equation:

HCl(aq) + NH3(aq) -> Cl-(aq) + NH4+(aq) 

Acid: HCl

Base: NH3

300

In each pair of compounds, which one has the higher boiling point? 

CS2 vs. C2H4

GeH4 vs. PbH4

Ar vs. Ne

CS2

PbH4

Ar

300

A chemist must dilute 90.4 mL of 6.71 mM aqueous copper(II) fluoride (CuF2) solution until the concentration falls to 1.00 mM. Calculate the final volume, in liters, round your answer to 3 sig figs. 

0.607 L

300

What is the solubility constant (Ksp) for CuCO3

Ksp = [Cu2+][CO32-]

300

if the pH of a solution is 3, what is the pOH? 

11

400

Are the following compounds capable of H-bond between itself and/or between itself and water:


CHClO


HF

CHClO: not between itself but yes between itself and water

HF: yes between itself and between itself and water

400

In the following reaction, what mass of NaHCO3 is needed to neutralize 150 mL of 0.051 M HCl solution? 

HCl + NaHCO3 → NaCl + H2O + CO2

0.64 g of NaHCO3

400

Consider the following reaction:

Fe2O3(s) + 3CO(g) -> 2Fe(s) + 3CO2(g)

Which reaction vessel would have a higher initial rate of reaction given the following conditions:

Vessel A: 2.0 L / 1200 °C

Vessel B: 4.0 L / 1100 °C

Vessel A

higher temp= more reactions between atoms

lower volume= more reactions between atoms

400

What is the equilibrium constant equation for the reaction of acetic acid (HCH3CO2)?

[H3O+][CH3CO2-]/[HCH3CO2]

500

Calculate the amount of heat needed to melt 32.4 g of acetic acid and bring it to a temperature of 109.8°C.

(The molar mass of acetic acid is 60.05 g/mol. The heat of fusion for acetic acid is 11.73 kJ/mol. The change in temp is 98 K. The specific heat capacity for acetic acid is 2.053 J/g*K.)

12.85 kJ

500

A chemistry student weighs out 0.0712 g of phosphoric acid (H3PO4) into 250 mL flask and dilutes to the mark with water. He plans to titrate the acid with 0.0600 M NaOH solution. 

Calculate the volume of NaOH in mL needed to reach the final equivalence point. The balanced equation is shown below: 

H3PO4 + 3 OH- → PO43- + 3 H2O

36.3 mL

500

Determine Kc for the following reaction: 

Ti(s) + 2 Cl2(g) → TiCl4(l)

The reaction happens in a 7.4 L vessel.

Ti = 3.11 g, Cl2 = 2.71 g, TiCl4 = 2.25 g

(write out the expression for Kc, and make sure you convert everything into concentrations!

Kc = 3743.4

500

A chemist dissolves 431 mg of HCl in 150 mL of solution. Calculate the pH of the solution. 

(hint: the molar mass of HCl is 36.458 g/mol)

pH = 1.1034