January 2024
Put these metals in order from the slowest to the fastest reaction with water: Potassium, lithium, sodium.
Lithium, Sodium, Potassium
Identify what is unusual about water's boiling point?
It has an unusually high boiling point.
Determine the #Atoms of each Element in the compound Copper (III) Phthalate: Cu3(C8H4O4)3.
Cu = 3
C = 8 x 3 = 24
H = 4 x 3 = 12
O = 4 x 3 = 12
If #mol Reactant #1 available greater than the #mol Reactant #1 needed, Name the Limiting Reactant and Excess Reactant.
LR = Reactant #2
ER = Reactant #1
What are ocean acidification's 2 nicknames.
Osteoporosis of the sea, and climate changes evil twin
What is Plasma
A gas in which the particles have so much energy that they have broken apart and become electrically charge.
How is Hydrogen bond usually represented?
By a dotted line that connects the hydrogen-bonded hydrogen to the partial negative charge on another molecule
Calculate the #g H2O produced if 6.35 g H2 are needed.
Answer these Questions based on the Problem above.
1. Which Town do you start in?
2. Which Town do you end in?
3. Which Streets do you drive on?
4. How many Fractions do you need to write for this conversion?
1. Massfield
2. Massfield
3. Molar Mass Drive, Molar Mass Way
4. 4 Fractions
Where is M, mol, and L located on the clarity triangle?
mol: top
M: bottom left
L: bottom right
If we continue to increase [CO2] at the current rates, how will seawater pH change by the end of the century?
Seawater PH may decrease 120%
What is physical Property?
A property that can be measured or observed without changing the identity of matter.
What is the law of multiple proportions
When elements combined to form different compounds, the ratios of the masses of elements in all compounds were reducible to small, whole numbers.
BCE: C3H8(g) + 5O2(g) ---> 3CO2(g) + 4H2O(g)
Calculate the #mol O2 needed to react when 8.917 mol H2O are produced.
(8.917 mol H2O) (5 mol O2)
1 (4 mol H2O)
= 11.15 mol O2
Which parts of the equation is the BLA, BLB, CA, and CB
C2O4^-2 (aq) + HC2H3O2 (aq) ⇌ C2H3O2^-1 (aq) + HC2O4^-1 (aq)
BLA: HC2H3O2
BLB: C2O4^-2
CA: HC2O4^-1
CB: C2H3O2^-1
What are Pteropods?
A group of sea snails, and other marine organisms.
A balloon is filled with 68.76 L of air at a pressure of 935 torr. calculate the pressure of the balloon if the volume is changed to 83.40 L
P2=770.9 torr
Solid Magnesium metal reacts w/ liquid water to form solid Magnesium hydroxide and hydrogen gas
Mg(s) + H2O(L) = Mg(OH)2(s) +H2(g)
Write the fractions you would need to complete this calculation.
Calculate the #mol H2 needed if 66.9 g O2 are used.
BCE = 2H2(g) + O2(g) ---> 2H2O(g)
MM(H2) = 2.02 g/mol, MM(O2) = 32.00 g/mol
Fraction #1: (66.9 g O2 / 1)
Fraction #2: (1 mol O2 / 32.00 g O2)
Fraction #3: (2 mol H2 / 1 mol O2)
Calculate the Molarity of Solution prepared by dissolving 75.6 g Ca(NO3)2 in enough water to make 10.52 L of Solution. (Use your roadmap)
0.0438 M Ca(NO3)2
Calculate pH of a 9.3 x 10-11 M OH-1 aqueous solution at 25C. State whether aqueous solution is Acidic, Basic, or neutral
PH=3.96
Acidic
A balloon is filled with 38.61 L of air at a pressure of 627 mmHg. Calculate the volume of the balloon if the pressure is changed to 961 mmHg.
V2=25.2 L
Solid Ammonium Dichromate decomposes to solid chromium(3) oxide, gaseous nitrogen, and gaseous water.
(NH4)2 Cr2O7(s)=Cr2O3(s)+N2(g)H2O(g)
Write the fractions you would need to complete this calculation.
Calculate the #g H2O produced if 82.5 g O2 are needed.
BCE = 2H2(g) + O2(g) ---> 2H2O(g)
MM(H2O) = 14.02 g/mol, MM(O2) = 32.00 g/mol
Fraction #1: (82.5 g O2 / 1)
Fraction #2: (1 mol O2 / 32.00 g O2)
Fraction #3: (2 mol H2O / 1 mol O2)
Fraction #4: (14.02 g H2O / 1 mol H2O)
Calculate the Volume of Solution in mL prepared from a 6.375 M Ni3(PO4)2 Solution made by dissolving 9.82 g Ni3(PO4)2 in water
4.21 mL Ni3(PO4)2
Calculate pOH of a 5.4 x 10-6 M OH-1 aqueous solution at 25C. State whether aqueous solution is Acidic, Basic, or neutral.
5.27
Basic