Layers
Where we live and breath. Also where the weather takes place.
What is the Troposphere?
Long, thin, wispy clouds made of ice.
What are Cirrus clouds?
Water in the form of gas.
What is water vapor?
The force pushing on an area or surface.
What is Pressure?
The envelope of gases surrounding the planet.
What is the Atmosphere?
The layer of the atmosphere where meteors burn up.
What is the Mesosphere?
Puffy white or gray clouds that grow vertically to the ground.
What are Cumulus clouds?
Gas that makes up most of the atmosphere.
What is nitrogen?
The result of the weight of a column of air pushing down on an area.
What is air pressure?
The distance above sea level.
What is altidude?
The outermost and thinnest layer. Going out into space.
What is the Exosphere?
Low clouds that can sometimes touch the ground. Fog.
What are Stratus clouds?
Second most abundant gas in the atmosphere.
What is Oxygen?
An instrument used to measure air pressure.
What is a barometer?
The amount of gas in a given volume
What is Density?
Creates electrically charged particles called ions.
What is the Ionosphere?
Large cloud that typically creates a thunderstorm.
What are Cumulonimbus clouds?
Air molecule with three oxygen atoms instead of two.
What is Ozone?
A barometer with an open glass tube partially filled with mercury.
What is a mercury barometer?
The condition of Earth’s atmosphere at a particular time and place.
What is Weather?
Blocks harmful UV radiation.
What is the Ozone layer?
Gray or blue-gray clouds that typically cover the whole sky. It is common for the sun or moon to shine through.
What are Altostratus clouds?
Man made gas that causes ozone depletion.
What are Chlorofluorocarbons(CFCs)?
Has an airtight metal chamber and means “without liquid.”
What is an aneroid barometer?
Forms when energy from the sun causes gas molecules to become electrically charged.
What are Ions?