Solutions
This is the component of a solution which is dissolved.
What is the solute?
This is the percentage of the total mass of solution that comes from an indicated species.
What is mass percent?
These types of reactions don't go to completion, but instead reach dynamic equilibrium.
What are reversible reactions?
This is what the value of the equilibrium constant tells us.
What is the ratio of products to reactants present at equilibrium for a reaction at a specific temperature.
This is what the value of Q tells us.
What is the ratio of products to reactants present at any point other that equilibrium for a reaction at a specific temperature?
This describes a solution with a relatively low amount of solute per unit volume.
What is dilute?
When calculating the mole fraction, this is what should be in the denominator.
What is the sum of the moles of solute and moles of solvent (moles of solution)?
These values are equal to each other when a reaction is at equilibrium.
What are the rates of the forward and reverse reactions?
These indicate that the associated value shows the molarity of a specific solute.
What are square brackets?
This relationship between Q and K indicates that the reverse reaction will proceed until equilibrium is reached.
What is K<Q ?
These are the three major factors influencing rate of solvation.
What are surface area of the solute, agitation, and temperature of the solvent?
This is the molarity when 0.25 mol of NaCl are dissolved in 2000 mL of water.
What is 0.125 M (mol/L)?
These types of reactants and products should not be included in the equilibrium expression.
What are solids and liquids?
These are the values that the equilibrium expression should be written in terms of if the reversible reaction consists of gaseous reactants and products.
What are partial pressures?
This is the conclusion made about whether or not the reaction:
2 N2 (g) + O2 (g) <-> 2 N2O (g)
is at equilibrium if K = 4.08 x 108 and [N2] = 2.0x10-4 M, [O2] = 0.00245 M, and [N2O] = 0.2 M.
What is "the system is at equilibrium"?
This is the general rule of solubility.
What is "Like dissolves like"?
This is the volume of 6.0 M stock HCl solution that should be used to prepare 450 mL of 0.880 M HCl solution.
What is 0.066 L (66 mL)?
This is how reactant and product concentrations change once equilibrium has been reached.
What is "concentrations do not change (are constant) at equilibrium"?
This is the equilibrium expression for the reaction:
CO2 (g) + Li2O (s) <-> Li2CO3 (s)
What is K = 1/PCO2
This is the direction the following reaction would shift if O2 was removed:
2 BaO2 (s) <-> 2 BaO (s) + O2 (g)
What is forward/right/toward products?
These are the three steps in creating a supersaturated solution.
What are heat the saturated solution, add and dissolve more solute, and allow the now supersaturated solution to slowly cool.
This is the mass, in grams, of KCl (molar mass = 74.55 g/mol) needed to completely react with 1.47 L of a 0.136 M (Pb(NO3)2 solution according to the equation:
2 KCl + Pb(NO3)2 -> 2 KNO3 + PbCl2
What is 31.8 g KCl?
This is the equilibrium expression for the reaction:
CH3COOH(aq) + H2O(l)<>CH3COO-(aq) + H3O+(aq)
What is K = [CH3COO-][H3O+]/[CH3COOH] ?
What is the value of K if in the reaction
2 NO (g) + O2 (g) <-> 2 NO2 (g)
is performed and the concentrations of the reacting species at equilibrium are found to be [NO] = 0.0542 M, [O2] = 0.127 M, and [NO2] = 15.5 M.
What is 6.44 x 105?
This is the direction the following reaction would shift if the volume was increased:
2 BaO2 (s) <-> 2 BaO (s) + O2 (g)
What is forward/right/toward products?